C12H17ClN2O4 — CID 163330060
methyl 4-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2,4-dioxobutanoate;hydrochloride (PubChem CID 163330060) has the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. Its IUPAC name is methyl 4-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2,4-dioxobutanoate;hydrochloride.
| Compound Name | methyl 4-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2,4-dioxobutanoate;hydrochloride |
|---|---|
| PubChem CID | 163330060 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl 4-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2,4-dioxobutanoate;hydrochloride |
| SMILES | CCn1nc(C)c(C(=O)CC(=O)C(=O)OC)c1C.Cl |
| InChI | InChI=1S/C12H16N2O4.ClH/c1-5-14-8(3)11(7(2)13-14)9(15)6-10(16)12(17)18-4;/h5-6H2,1-4H3;1H |
| InChIKey | SVUVILUHASVXQD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|