C50H62N4O18 — CID 163330821
bis(N-[[5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine);oxalic acid (PubChem CID 163330821) has the molecular formula C50H62N4O18 and a molecular weight of 1007.06 g/mol. Its IUPAC name is bis(N-[[5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine);oxalic acid.
| Compound Name | bis(N-[[5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine);oxalic acid |
|---|---|
| PubChem CID | 163330821 |
| Molecular Formula | C50H62N4O18 |
| Molecular Weight | 1007.06 g/mol |
| Exact Mass | 1006.41 |
| IUPAC Name | bis(N-[[5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine);oxalic acid |
| SMILES | COc1ccc(CCNCC2=NOC(Cc3cc(OC)c4c(c3OC)OCO4)C2)cc1OC.COc1ccc(CCNCC2=NOC(Cc3cc(OC)c4c(c3OC)OCO4)C2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/2C24H30N2O7.C2H2O4/c2*1-27-19-6-5-15(9-20(19)28-2)7-8-25-13-17-12-18(33-26-17)10-16-11-21(29-3)23-24(22(16)30-4)32-14-31-23;3-1(4)2(5)6/h2*5-6,9,11,18,25H,7-8,10,12-14H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | CZTSRUDOHOKLMQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 252.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.06 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|