C50H56N6O12 — CID 163330831
bis(N-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(2-methyl-1H-indol-3-yl)ethanamine);oxalic acid (PubChem CID 163330831) has the molecular formula C50H56N6O12 and a molecular weight of 933.03 g/mol. Its IUPAC name is bis(N-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(2-methyl-1H-indol-3-yl)ethanamine);oxalic acid.
| Compound Name | bis(N-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(2-methyl-1H-indol-3-yl)ethanamine);oxalic acid |
|---|---|
| PubChem CID | 163330831 |
| Molecular Formula | C50H56N6O12 |
| Molecular Weight | 933.03 g/mol |
| Exact Mass | 932.40 |
| IUPAC Name | bis(N-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]-2-(2-methyl-1H-indol-3-yl)ethanamine);oxalic acid |
| SMILES | COc1cc(CC2CC(CNCCc3c(C)[nH]c4ccccc34)=NO2)cc2c1OCO2.COc1cc(CC2CC(CNCCc3c(C)[nH]c4ccccc34)=NO2)cc2c1OCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/2C24H27N3O4.C2H2O4/c2*1-15-19(20-5-3-4-6-21(20)26-15)7-8-25-13-17-12-18(31-27-17)9-16-10-22(28-2)24-23(11-16)29-14-30-24;3-1(4)2(5)6/h2*3-6,10-11,18,25-26H,7-9,12-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | FBWAXZOEZHRKIZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 228.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.03 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|