C19H24N2O9 — CID 90485935
4-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]morpholine;oxalic acid (PubChem CID 90485935) has the molecular formula C19H24N2O9 and a molecular weight of 424.41 g/mol. Its IUPAC name is 4-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]morpholine;oxalic acid.
| Compound Name | 4-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]morpholine;oxalic acid |
|---|---|
| PubChem CID | 90485935 |
| Molecular Formula | C19H24N2O9 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 4-[[5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl]morpholine;oxalic acid |
| SMILES | COc1cc(CC2CC(CN3CCOCC3)=NO2)cc2c1OCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H22N2O5.C2H2O4/c1-20-15-7-12(8-16-17(15)23-11-22-16)6-14-9-13(18-24-14)10-19-2-4-21-5-3-19;3-1(4)2(5)6/h7-8,14H,2-6,9-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | VXUCCBDPKNDGRX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|