C17H18N4O5S — CID 163333624
formic acid;3-methyl-N-[(4-sulfamoylphenyl)methyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 163333624) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is formic acid;3-methyl-N-[(4-sulfamoylphenyl)methyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | formic acid;3-methyl-N-[(4-sulfamoylphenyl)methyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163333624 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | formic acid;3-methyl-N-[(4-sulfamoylphenyl)methyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccc(S(N)(=O)=O)cc2)nc2ccccn12.O=CO |
| InChI | InChI=1S/C16H16N4O3S.CH2O2/c1-11-15(19-14-4-2-3-9-20(11)14)16(21)18-10-12-5-7-13(8-6-12)24(17,22)23;2-1-3/h2-9H,10H2,1H3,(H,18,21)(H2,17,22,23);1H,(H,2,3) |
| InChIKey | CSKWMXGRWGEUKF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|