C14H17ClN2OS — CID 163334626
[(3R)-3-aminopyrrolidin-1-yl]-(2-methyl-1-benzothiophen-3-yl)methanone;hydrochloride (PubChem CID 163334626) has the molecular formula C14H17ClN2OS and a molecular weight of 296.82 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-(2-methyl-1-benzothiophen-3-yl)methanone;hydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-(2-methyl-1-benzothiophen-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 163334626 |
| Molecular Formula | C14H17ClN2OS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-(2-methyl-1-benzothiophen-3-yl)methanone;hydrochloride |
| SMILES | Cc1sc2ccccc2c1C(=O)N1CC[C@@H](N)C1.Cl |
| InChI | InChI=1S/C14H16N2OS.ClH/c1-9-13(11-4-2-3-5-12(11)18-9)14(17)16-7-6-10(15)8-16;/h2-5,10H,6-8,15H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | FDRGOLGIZKJUIV-HNCPQSOCSA-N |
| XLogP | 2.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |