C17H28N4O2 — CID 163336105
2-ethyl-1-[(1R,9S)-4-(2-methoxyethyl)-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]butan-1-one (PubChem CID 163336105) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-ethyl-1-[(1R,9S)-4-(2-methoxyethyl)-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]butan-1-one.
| Compound Name | 2-ethyl-1-[(1R,9S)-4-(2-methoxyethyl)-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]butan-1-one |
|---|---|
| PubChem CID | 163336105 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-ethyl-1-[(1R,9S)-4-(2-methoxyethyl)-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]butan-1-one |
| SMILES | CCC(CC)C(=O)N1[C@@H]2CC[C@H]1Cc1nnc(CCOC)n1C2 |
| InChI | InChI=1S/C17H28N4O2/c1-4-12(5-2)17(22)21-13-6-7-14(21)11-20-15(8-9-23-3)18-19-16(20)10-13/h12-14H,4-11H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | FRMNNBAXZNHQLC-UONOGXRCSA-N |
| XLogP | 1.82 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |