C22H21N3O6 — CID 163338159
formic acid;N-[4-(4-methoxyphenyl)-3-methyl-1,2-oxazol-5-yl]-2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide (PubChem CID 163338159) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is formic acid;N-[4-(4-methoxyphenyl)-3-methyl-1,2-oxazol-5-yl]-2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide.
| Compound Name | formic acid;N-[4-(4-methoxyphenyl)-3-methyl-1,2-oxazol-5-yl]-2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 163338159 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | formic acid;N-[4-(4-methoxyphenyl)-3-methyl-1,2-oxazol-5-yl]-2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide |
| SMILES | COc1ccc(-c2c(C)noc2NC(=O)CC2NC(=O)c3ccccc32)cc1.O=CO |
| InChI | InChI=1S/C21H19N3O4.CH2O2/c1-12-19(13-7-9-14(27-2)10-8-13)21(28-24-12)23-18(25)11-17-15-5-3-4-6-16(15)20(26)22-17;2-1-3/h3-10,17H,11H2,1-2H3,(H,22,26)(H,23,25);1H,(H,2,3) |
| InChIKey | ADSMHMQQJPGCNE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|