C26H33N3O3 — CID 163338350
N-[3-(4-benzylpiperidin-1-yl)propyl]-2-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl)acetamide (PubChem CID 163338350) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-2-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl)acetamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-2-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl)acetamide |
|---|---|
| PubChem CID | 163338350 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-2-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl)acetamide |
| SMILES | O=C(CC1COc2ccccc2NC1=O)NCCCN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H33N3O3/c30-25(18-22-19-32-24-10-5-4-9-23(24)28-26(22)31)27-13-6-14-29-15-11-21(12-16-29)17-20-7-2-1-3-8-20/h1-5,7-10,21-22H,6,11-19H2,(H,27,30)(H,28,31) |
| InChIKey | DBTBSZOHAFKWQT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|