C12H20N4O6S — CID 163341199
N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanamide;formic acid (PubChem CID 163341199) has the molecular formula C12H20N4O6S and a molecular weight of 348.38 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanamide;formic acid.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanamide;formic acid |
|---|---|
| PubChem CID | 163341199 |
| Molecular Formula | C12H20N4O6S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanamide;formic acid |
| SMILES | CCN(C(=O)CCc1n[nH]c(=O)[nH]1)C1CCS(=O)(=O)C1.O=CO |
| InChI | InChI=1S/C11H18N4O4S.CH2O2/c1-2-15(8-5-6-20(18,19)7-8)10(16)4-3-9-12-11(17)14-13-9;2-1-3/h8H,2-7H2,1H3,(H2,12,13,14,17);1H,(H,2,3) |
| InChIKey | IFYVYUPMUUSUHY-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 153.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|