C15H14FN5O3 — CID 163341612
N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-5-methyl-1H-pyrazole-3-carboxamide;formic acid (PubChem CID 163341612) has the molecular formula C15H14FN5O3 and a molecular weight of 331.31 g/mol. Its IUPAC name is N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-5-methyl-1H-pyrazole-3-carboxamide;formic acid.
| Compound Name | N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-5-methyl-1H-pyrazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 163341612 |
| Molecular Formula | C15H14FN5O3 |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-5-methyl-1H-pyrazole-3-carboxamide;formic acid |
| SMILES | Cc1cc(C(=O)Nc2cc(-c3ccc(F)cc3)[nH]n2)n[nH]1.O=CO |
| InChI | InChI=1S/C14H12FN5O.CH2O2/c1-8-6-12(19-17-8)14(21)16-13-7-11(18-20-13)9-2-4-10(15)5-3-9;2-1-3/h2-7H,1H3,(H,17,19)(H2,16,18,20,21);1H,(H,2,3) |
| InChIKey | APXLTNVYVVVPKS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|