About 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine
6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine (PubChem CID 163344989) has the molecular formula C17H19N9
and a molecular weight of 349.40 g/mol. Its IUPAC name is 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine.
Molecular Properties
| Compound Name | 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine |
| PubChem CID | 163344989 |
| Molecular Formula | C17H19N9 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine |
| SMILES | Cn1cnc2ncnc(N3CCCN(c4ccc5nccn5n4)CC3)c21 |
| InChI | InChI=1S/C17H19N9/c1-23-12-21-16-15(23)17(20-11-19-16)25-7-2-6-24(9-10-25)14-4-3-13-18-5-8-26(13)22-14/h3-5,8,11-12H,2,6-7,9-10H2,1H3 |
| InChIKey | XXJWTHGGXMOBML-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine?
The IUPAC name of 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine (CID 163344989) is 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine.
What is the SMILES notation for 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine?
The canonical SMILES for 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine is Cn1cnc2ncnc(N3CCCN(c4ccc5nccn5n4)CC3)c21.
What is the InChIKey of 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine?
The InChIKey is XXJWTHGGXMOBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N9/c1-23-12-21-16-15(23)17(20-11-19-16)25-7-2-6-24(9-10-25)14-4-3-13-18-5-8-26(13)22-14/h3-5,8,11-12H,2,6-7,9-10H2,1H3.
What are the key properties of 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine?
6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine has a molecular weight of 349.40 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-imidazo[1,2-b]pyridazin-6-yl-1,4-diazepan-1-yl)-7-methylpurine is sourced from PubChem (CID 163344989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).