C17H29N3O4 — CID 163345105
N-(oxolan-2-ylmethyl)-2-[2-(piperidine-1-carbonyl)morpholin-4-yl]acetamide (PubChem CID 163345105) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-[2-(piperidine-1-carbonyl)morpholin-4-yl]acetamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-[2-(piperidine-1-carbonyl)morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 163345105 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-[2-(piperidine-1-carbonyl)morpholin-4-yl]acetamide |
| SMILES | O=C(CN1CCOC(C(=O)N2CCCCC2)C1)NCC1CCCO1 |
| InChI | InChI=1S/C17H29N3O4/c21-16(18-11-14-5-4-9-23-14)13-19-8-10-24-15(12-19)17(22)20-6-2-1-3-7-20/h14-15H,1-13H2,(H,18,21) |
| InChIKey | CGKCBIVGADLHTE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |