C17H21N7O — CID 163348419
7,9-dimethyl-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]purin-8-one (PubChem CID 163348419) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is 7,9-dimethyl-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]purin-8-one.
| Compound Name | 7,9-dimethyl-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]purin-8-one |
|---|---|
| PubChem CID | 163348419 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 7,9-dimethyl-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]purin-8-one |
| SMILES | Cn1c(=O)n(C)c2c(N3CCN(Cc4cccnc4)CC3)ncnc21 |
| InChI | InChI=1S/C17H21N7O/c1-21-14-15(22(2)17(21)25)19-12-20-16(14)24-8-6-23(7-9-24)11-13-4-3-5-18-10-13/h3-5,10,12H,6-9,11H2,1-2H3 |
| InChIKey | WQPPHTARHNARCP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |