C17H16ClNO3S2 — CID 163350083
1-(3-chlorophenyl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]methanesulfonamide (PubChem CID 163350083) has the molecular formula C17H16ClNO3S2 and a molecular weight of 381.91 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]methanesulfonamide.
| Compound Name | 1-(3-chlorophenyl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 163350083 |
| Molecular Formula | C17H16ClNO3S2 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(Cl)c1)NCCc1ccc(-c2ccco2)s1 |
| InChI | InChI=1S/C17H16ClNO3S2/c18-14-4-1-3-13(11-14)12-24(20,21)19-9-8-15-6-7-17(23-15)16-5-2-10-22-16/h1-7,10-11,19H,8-9,12H2 |
| InChIKey | VBNAYPKNDIQALY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |