C16H18N8 — CID 163352906
2-(1-methylpyrazol-4-yl)-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazine (PubChem CID 163352906) has the molecular formula C16H18N8 and a molecular weight of 322.38 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazine.
| Compound Name | 2-(1-methylpyrazol-4-yl)-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazine |
|---|---|
| PubChem CID | 163352906 |
| Molecular Formula | C16H18N8 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazine |
| SMILES | Cn1cc(-c2cncc(N3CCN(c4ncccn4)CC3)n2)cn1 |
| InChI | InChI=1S/C16H18N8/c1-22-12-13(9-20-22)14-10-17-11-15(21-14)23-5-7-24(8-6-23)16-18-3-2-4-19-16/h2-4,9-12H,5-8H2,1H3 |
| InChIKey | ZFMCVFAFLMLKJZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |