About 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide
3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide (PubChem CID 163352482) has the molecular formula C19H19N7O2S
and a molecular weight of 409.48 g/mol. Its IUPAC name is 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide |
| PubChem CID | 163352482 |
| Molecular Formula | C19H19N7O2S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide |
| SMILES | Cn1cc(-c2cncc(N3CCN(C4=NS(=O)(=O)c5ccccc54)CC3)n2)cn1 |
| InChI | InChI=1S/C19H19N7O2S/c1-24-13-14(10-21-24)16-11-20-12-18(22-16)25-6-8-26(9-7-25)19-15-4-2-3-5-17(15)29(27,28)23-19/h2-5,10-13H,6-9H2,1H3 |
| InChIKey | RKBKFMAZNQOTKF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide?
The IUPAC name of 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide (CID 163352482) is 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide.
What is the SMILES notation for 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide?
The canonical SMILES for 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide is Cn1cc(-c2cncc(N3CCN(C4=NS(=O)(=O)c5ccccc54)CC3)n2)cn1.
What is the InChIKey of 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide?
The InChIKey is RKBKFMAZNQOTKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N7O2S/c1-24-13-14(10-21-24)16-11-20-12-18(22-16)25-6-8-26(9-7-25)19-15-4-2-3-5-17(15)29(27,28)23-19/h2-5,10-13H,6-9H2,1H3.
What are the key properties of 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide?
3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide has a molecular weight of 409.48 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]piperazin-1-yl]-1,2-benzothiazole 1,1-dioxide is sourced from PubChem (CID 163352482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).