C13H25BLiNO3S — CID 163353578
lithium (5-methyl-1,3-thiazol-2-yl)-tri(propan-2-yloxy)boranuide (PubChem CID 163353578) has the molecular formula C13H25BLiNO3S and a molecular weight of 293.17 g/mol. Its IUPAC name is lithium (5-methyl-1,3-thiazol-2-yl)-tri(propan-2-yloxy)boranuide.
| Compound Name | lithium (5-methyl-1,3-thiazol-2-yl)-tri(propan-2-yloxy)boranuide |
|---|---|
| PubChem CID | 163353578 |
| Molecular Formula | C13H25BLiNO3S |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | lithium (5-methyl-1,3-thiazol-2-yl)-tri(propan-2-yloxy)boranuide |
| SMILES | Cc1cnc([B-](OC(C)C)(OC(C)C)OC(C)C)s1.[Li+] |
| InChI | InChI=1S/C13H25BNO3S.Li/c1-9(2)16-14(17-10(3)4,18-11(5)6)13-15-8-12(7)19-13;/h8-11H,1-7H3;/q-1;+1 |
| InChIKey | FGOLJPCYPZBSFR-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|