About N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide
N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide (PubChem CID 163357192) has the molecular formula C18H21FN4O2
and a molecular weight of 344.40 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide |
| PubChem CID | 163357192 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-(2-fluorophenyl)-2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]acetamide |
| SMILES | C1CC(CN(C1)CC(=O)NC2=CC=CC=C2F)COC3=NC=CN=C3 |
| InChI | InChI=1S/C18H21FN4O2/c19-15-5-1-2-6-16(15)22-17(24)12-23-9-3-4-14(11-23)13-25-18-10-20-7-8-21-18/h1-2,5-8,10,14H,3-4,9,11-13H2,(H,22,24) |
| InChIKey | RFDQXKWJDCZZPB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | 426 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide?
The IUPAC name of N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide (CID 163357192) is N-(2-fluorophenyl)-2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]acetamide.
What is the SMILES notation for N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide?
The canonical SMILES for N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide is C1CC(CN(C1)CC(=O)NC2=CC=CC=C2F)COC3=NC=CN=C3.
What is the InChIKey of N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide?
The InChIKey is RFDQXKWJDCZZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21FN4O2/c19-15-5-1-2-6-16(15)22-17(24)12-23-9-3-4-14(11-23)13-25-18-10-20-7-8-21-18/h1-2,5-8,10,14H,3-4,9,11-13H2,(H,22,24).
What are the key properties of N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide?
N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide has a molecular weight of 344.40 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-2-{3-[(pyrazin-2-yloxy)methyl]piperidin-1-yl}acetamide is sourced from PubChem (CID 163357192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).