C19H21F3N4O2 — CID 163357417
2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 163357417) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is 2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 163357417 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCCC(COc2cnccn2)C1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N4O2/c20-19(21,22)15-4-1-5-16(9-15)25-17(27)12-26-8-2-3-14(11-26)13-28-18-10-23-6-7-24-18/h1,4-7,9-10,14H,2-3,8,11-13H2,(H,25,27) |
| InChIKey | BMKAQGUHGJTTLC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |