C18H20FN5O2 — CID 163358450
3-[2-[2-(5-fluoro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-6-methylpyrimidin-4-one (PubChem CID 163358450) has the molecular formula C18H20FN5O2 and a molecular weight of 357.39 g/mol. Its IUPAC name is 3-[2-[2-(5-fluoro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-6-methylpyrimidin-4-one.
| Compound Name | 3-[2-[2-(5-fluoro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 163358450 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-[2-[2-(5-fluoro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-6-methylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(CC(=O)N2CC3CN(c4ccc(F)cn4)CC3C2)cn1 |
| InChI | InChI=1S/C18H20FN5O2/c1-12-4-17(25)24(11-21-12)10-18(26)23-8-13-6-22(7-14(13)9-23)16-3-2-15(19)5-20-16/h2-5,11,13-14H,6-10H2,1H3 |
| InChIKey | WOHNRLKBZAJMAM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |