C20H21N3O4 — CID 163358794
5-[(2Z,4E)-2-hydroxy-5-(2-methyl-2,3-dihydroindol-1-yl)penta-2,4-dienylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 163358794) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 5-[(2Z,4E)-2-hydroxy-5-(2-methyl-2,3-dihydroindol-1-yl)penta-2,4-dienylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2Z,4E)-2-hydroxy-5-(2-methyl-2,3-dihydroindol-1-yl)penta-2,4-dienylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 163358794 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 5-[(2Z,4E)-2-hydroxy-5-(2-methyl-2,3-dihydroindol-1-yl)penta-2,4-dienylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC1Cc2ccccc2N1/C=C/C=C(\O)C=C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C20H21N3O4/c1-13-11-14-7-4-5-9-17(14)23(13)10-6-8-15(24)12-16-18(25)21(2)20(27)22(3)19(16)26/h4-10,12-13,24H,11H2,1-3H3/b10-6+,15-8- |
| InChIKey | NNLVQKKLPZLNDA-MEEUMAGESA-N |
| XLogP | 2.37 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|