C22H22N4O3 — CID 163362078
2-(5-amino-1H-indol-3-yl)-N-[1-[(4-methylphenyl)methyl]-2-oxopyrrolidin-3-yl]-2-oxoacetamide (PubChem CID 163362078) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-(5-amino-1H-indol-3-yl)-N-[1-[(4-methylphenyl)methyl]-2-oxopyrrolidin-3-yl]-2-oxoacetamide.
| Compound Name | 2-(5-amino-1H-indol-3-yl)-N-[1-[(4-methylphenyl)methyl]-2-oxopyrrolidin-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 163362078 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-(5-amino-1H-indol-3-yl)-N-[1-[(4-methylphenyl)methyl]-2-oxopyrrolidin-3-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(CN2CCC(NC(=O)C(=O)c3c[nH]c4ccc(N)cc34)C2=O)cc1 |
| InChI | InChI=1S/C22H22N4O3/c1-13-2-4-14(5-3-13)12-26-9-8-19(22(26)29)25-21(28)20(27)17-11-24-18-7-6-15(23)10-16(17)18/h2-7,10-11,19,24H,8-9,12,23H2,1H3,(H,25,28) |
| InChIKey | OPBRSWJIQBOWAI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|