C14H15N3O3 — CID 163362453
2-(2,6-dihydroxypiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonitrile (PubChem CID 163362453) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-(2,6-dihydroxypiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonitrile.
| Compound Name | 2-(2,6-dihydroxypiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonitrile |
|---|---|
| PubChem CID | 163362453 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-(2,6-dihydroxypiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CN(C1CCC(O)NC1O)C2=O |
| InChI | InChI=1S/C14H15N3O3/c15-6-8-1-2-10-9(5-8)7-17(14(10)20)11-3-4-12(18)16-13(11)19/h1-2,5,11-13,16,18-19H,3-4,7H2 |
| InChIKey | ZOCPEXXJLNMFPQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |