C14H13N3O4 — CID 163362452
2-(2,6-dihydroxypiperidin-3-yl)-1,3-dioxoisoindole-5-carbonitrile (PubChem CID 163362452) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-(2,6-dihydroxypiperidin-3-yl)-1,3-dioxoisoindole-5-carbonitrile.
| Compound Name | 2-(2,6-dihydroxypiperidin-3-yl)-1,3-dioxoisoindole-5-carbonitrile |
|---|---|
| PubChem CID | 163362452 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(2,6-dihydroxypiperidin-3-yl)-1,3-dioxoisoindole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C(=O)N(C1CCC(O)NC1O)C2=O |
| InChI | InChI=1S/C14H13N3O4/c15-6-7-1-2-8-9(5-7)14(21)17(13(8)20)10-3-4-11(18)16-12(10)19/h1-2,5,10-12,16,18-19H,3-4H2 |
| InChIKey | YASRXSVTLGIKSF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|