C21H27N3O4 — CID 176705298
5-(7-azaspiro[3.5]nonan-2-yl)-2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-dione (PubChem CID 176705298) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-(7-azaspiro[3.5]nonan-2-yl)-2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-(7-azaspiro[3.5]nonan-2-yl)-2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 176705298 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 5-(7-azaspiro[3.5]nonan-2-yl)-2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(C3CC4(CCNCC4)C3)cc2C(=O)N1C1CCC(O)NC1O |
| InChI | InChI=1S/C21H27N3O4/c25-17-4-3-16(18(26)23-17)24-19(27)14-2-1-12(9-15(14)20(24)28)13-10-21(11-13)5-7-22-8-6-21/h1-2,9,13,16-18,22-23,25-26H,3-8,10-11H2 |
| InChIKey | OLFOJPZXVBJGMH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|