C15H16N2O4 — CID 143637983
5-ethyl-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 143637983) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 5-ethyl-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-ethyl-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 143637983 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 5-ethyl-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1O)C2=O |
| InChI | InChI=1S/C15H16N2O4/c1-2-8-3-4-9-10(7-8)15(21)17(14(9)20)11-5-6-12(18)16-13(11)19/h3-4,7,11,13,19H,2,5-6H2,1H3,(H,16,18) |
| InChIKey | MPYRRXSKBVWRNQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|