C18H21N3O5 — CID 146558902
5-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 146558902) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 5-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 146558902 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 5-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCC[C@H]4CO)cc3C2=O)C(O)N1 |
| InChI | InChI=1S/C18H21N3O5/c22-9-11-2-1-7-20(11)10-3-4-12-13(8-10)18(26)21(17(12)25)14-5-6-15(23)19-16(14)24/h3-4,8,11,14,16,22,24H,1-2,5-7,9H2,(H,19,23)/t11-,14?,16?/m0/s1 |
| InChIKey | AGOUNZILOJCCQE-WJFWJRBTSA-N |
| XLogP | -0.16 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|