C36H40N6O6 — CID 167437316
5-[3-[4-[2-[4-[(2-aminopyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]propylamino]-2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167437316) has the molecular formula C36H40N6O6 and a molecular weight of 652.75 g/mol. Its IUPAC name is 5-[3-[4-[2-[4-[(2-aminopyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]propylamino]-2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[4-[2-[4-[(2-aminopyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]propylamino]-2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167437316 |
| Molecular Formula | C36H40N6O6 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | 5-[3-[4-[2-[4-[(2-aminopyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]propylamino]-2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC(C)(c1ccc(OCCCNc2ccc3c(c2)C(=O)N(C2CCC(O)NC2O)C3=O)cc1)c1ccc(OCc2ccnc(N)n2)cc1 |
| InChI | InChI=1S/C36H40N6O6/c1-36(2,23-6-11-27(12-7-23)48-21-25-16-18-39-35(37)40-25)22-4-9-26(10-5-22)47-19-3-17-38-24-8-13-28-29(20-24)34(46)42(33(28)45)30-14-15-31(43)41-32(30)44/h4-13,16,18,20,30-32,38,41,43-44H,3,14-15,17,19,21H2,1-2H3,(H2,37,39,40) |
| InChIKey | PPKFUCAHOASXPY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|