C13H14INO2S — CID 163367201
ethyl 7-iodo-3-propan-2-ylthieno[2,3-c]pyridine-2-carboxylate (PubChem CID 163367201) has the molecular formula C13H14INO2S and a molecular weight of 375.23 g/mol. Its IUPAC name is ethyl 7-iodo-3-propan-2-ylthieno[2,3-c]pyridine-2-carboxylate.
| Compound Name | ethyl 7-iodo-3-propan-2-ylthieno[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 163367201 |
| Molecular Formula | C13H14INO2S |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | ethyl 7-iodo-3-propan-2-ylthieno[2,3-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(I)nccc2c1C(C)C |
| InChI | InChI=1S/C13H14INO2S/c1-4-17-13(16)11-9(7(2)3)8-5-6-15-12(14)10(8)18-11/h5-7H,4H2,1-3H3 |
| InChIKey | DPUOWSASIXOFED-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|