C13H24ClN3 — CID 163367935
(E,4Z)-3-chloro-4-[1-[2-methylpropyl(propyl)amino]ethenylimino]but-2-en-2-amine (PubChem CID 163367935) has the molecular formula C13H24ClN3 and a molecular weight of 257.81 g/mol. Its IUPAC name is (E,4Z)-3-chloro-4-[1-[2-methylpropyl(propyl)amino]ethenylimino]but-2-en-2-amine.
| Compound Name | (E,4Z)-3-chloro-4-[1-[2-methylpropyl(propyl)amino]ethenylimino]but-2-en-2-amine |
|---|---|
| PubChem CID | 163367935 |
| Molecular Formula | C13H24ClN3 |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | (E,4Z)-3-chloro-4-[1-[2-methylpropyl(propyl)amino]ethenylimino]but-2-en-2-amine |
| SMILES | C=C(/N=C\C(Cl)=C(\C)N)N(CCC)CC(C)C |
| InChI | InChI=1S/C13H24ClN3/c1-6-7-17(9-10(2)3)12(5)16-8-13(14)11(4)15/h8,10H,5-7,9,15H2,1-4H3/b13-11+,16-8- |
| InChIKey | JDQXXNMSVSIKIN-QMAJRGFASA-N |
| XLogP | 3.33 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|