C13H11F2NO5 — CID 163368308
N-(2,3-difluorophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboxamide (PubChem CID 163368308) has the molecular formula C13H11F2NO5 and a molecular weight of 299.23 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboxamide.
| Compound Name | N-(2,3-difluorophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 163368308 |
| Molecular Formula | C13H11F2NO5 |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-(2,3-difluorophenyl)-4-hydroxy-2,2-dimethyl-6-oxo-1,3-dioxine-5-carboxamide |
| SMILES | CC1(C)OC(=O)C(C(=O)Nc2cccc(F)c2F)=C(O)O1 |
| InChI | InChI=1S/C13H11F2NO5/c1-13(2)20-11(18)8(12(19)21-13)10(17)16-7-5-3-4-6(14)9(7)15/h3-5,18H,1-2H3,(H,16,17) |
| InChIKey | NPHDDZUBKYSWCN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|