C17H20N2S — CID 163368828
3,5-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-imidazole-2-thione (PubChem CID 163368828) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 3,5-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-imidazole-2-thione.
| Compound Name | 3,5-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 163368828 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3,5-bis[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-imidazole-2-thione |
| SMILES | C=C/C=C\C(=C/C)c1cn(C(/C=C\C=C)=C/C)c(=S)[nH]1 |
| InChI | InChI=1S/C17H20N2S/c1-5-9-11-14(7-3)16-13-19(17(20)18-16)15(8-4)12-10-6-2/h5-13H,1-2H2,3-4H3,(H,18,20)/b11-9-,12-10-,14-7+,15-8+ |
| InChIKey | WKVREFPCAXHWCX-QKNWSJPTSA-N |
| XLogP | 5.29 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|