C9H13N3 — CID 163369234
6-cyclopropyl-N,4-dimethylpyridazin-3-amine (PubChem CID 163369234) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 6-cyclopropyl-N,4-dimethylpyridazin-3-amine.
| Compound Name | 6-cyclopropyl-N,4-dimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 163369234 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 6-cyclopropyl-N,4-dimethylpyridazin-3-amine |
| SMILES | CNc1nnc(C2CC2)cc1C |
| InChI | InChI=1S/C9H13N3/c1-6-5-8(7-3-4-7)11-12-9(6)10-2/h5,7H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | UPUDKUYGJWHLSN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |