C21H29F2N3O6S — CID 163370199
N-(3,5-difluoro-13-methyl-11-oxo-7,10,18-trioxa-12,24-diazatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide (PubChem CID 163370199) has the molecular formula C21H29F2N3O6S and a molecular weight of 489.54 g/mol. Its IUPAC name is N-(3,5-difluoro-13-methyl-11-oxo-7,10,18-trioxa-12,24-diazatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide.
| Compound Name | N-(3,5-difluoro-13-methyl-11-oxo-7,10,18-trioxa-12,24-diazatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide |
|---|---|
| PubChem CID | 163370199 |
| Molecular Formula | C21H29F2N3O6S |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-(3,5-difluoro-13-methyl-11-oxo-7,10,18-trioxa-12,24-diazatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide |
| SMILES | CC1CC(NS(C)(=O)=O)C2COC3CCC(CC3)c3nc(c(F)cc3F)OCCOC(=O)N12 |
| InChI | InChI=1S/C21H29F2N3O6S/c1-12-9-17(25-33(2,28)29)18-11-32-14-5-3-13(4-6-14)19-15(22)10-16(23)20(24-19)30-7-8-31-21(27)26(12)18/h10,12-14,17-18,25H,3-9,11H2,1-2H3 |
| InChIKey | AHDQPITWFVUJKR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |