About 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine
5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 163376472) has the molecular formula C7H7BrN4
and a molecular weight of 227.06 g/mol. Its IUPAC name is 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
Analyze 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine?
The IUPAC name of 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine (CID 163376472) is 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
What is the SMILES notation for 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine?
The canonical SMILES for 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine is Cc1cn2ncnc(N)c2c1Br.
What is the InChIKey of 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine?
The InChIKey is GJUIIGWSDOQFNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN4/c1-4-2-12-6(5(4)8)7(9)10-3-11-12/h2-3H,1H3,(H2,9,10,11).
What are the key properties of 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine?
5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine has a molecular weight of 227.06 g/mol, XLogP of 1.38, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine is sourced from PubChem (CID 163376472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).