About 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine
7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 164876385) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
Analyze 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
The IUPAC name of 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine (CID 164876385) is 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
What is the SMILES notation for 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
The canonical SMILES for 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine is Cc1c(N)cn2ncnc2c1C.
What is the InChIKey of 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
The InChIKey is NQPXNMUEVFZXFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-5-6(2)8-10-4-11-12(8)3-7(5)9/h3-4H,9H2,1-2H3.
What are the key properties of 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine has a molecular weight of 162.20 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine is sourced from PubChem (CID 164876385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).