About 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol
7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol (PubChem CID 162937311) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol.
Molecular Properties
| Compound Name | 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol |
| PubChem CID | 162937311 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol |
| SMILES | C=c1c(O)cn2ncnc12 |
| InChI | InChI=1S/C6H5N3O/c1-4-5(10)2-9-6(4)7-3-8-9/h2-3,10H,1H2 |
| InChIKey | ZNCZQYZOUYOGBQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol?
The IUPAC name of 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol (CID 162937311) is 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol.
What is the SMILES notation for 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol?
The canonical SMILES for 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol is C=c1c(O)cn2ncnc12.
What is the InChIKey of 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol?
The InChIKey is ZNCZQYZOUYOGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c1-4-5(10)2-9-6(4)7-3-8-9/h2-3,10H,1H2.
What are the key properties of 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol?
7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol has a molecular weight of 135.13 g/mol, XLogP of -0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidenepyrrolo[1,2-b][1,2,4]triazol-6-ol is sourced from PubChem (CID 162937311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).