C10H11Br2N3 — CID 129050183
6,8-dibromo-7-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 129050183) has the molecular formula C10H11Br2N3 and a molecular weight of 333.03 g/mol. Its IUPAC name is 6,8-dibromo-7-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6,8-dibromo-7-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 129050183 |
| Molecular Formula | C10H11Br2N3 |
| Molecular Weight | 333.03 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | 6,8-dibromo-7-tert-butyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC(C)(C)c1c(Br)cn2ncnc2c1Br |
| InChI | InChI=1S/C10H11Br2N3/c1-10(2,3)7-6(11)4-15-9(8(7)12)13-5-14-15/h4-5H,1-3H3 |
| InChIKey | HNPZOLJIVGZEGW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.03 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |