C15H14ClN3 — CID 118234399
8-(chloromethyl)-6-(2,6-dimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 118234399) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 8-(chloromethyl)-6-(2,6-dimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-(chloromethyl)-6-(2,6-dimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 118234399 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 8-(chloromethyl)-6-(2,6-dimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cccc(C)c1-c1cc(CCl)c2ncnn2c1 |
| InChI | InChI=1S/C15H14ClN3/c1-10-4-3-5-11(2)14(10)13-6-12(7-16)15-17-9-18-19(15)8-13/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | CVAWZDSRARCVBH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|