C8H9N3O — CID 172784495
8-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 172784495) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 8-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 172784495 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 8-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COCc1cccn2ncnc12 |
| InChI | InChI=1S/C8H9N3O/c1-12-5-7-3-2-4-11-8(7)9-6-10-11/h2-4,6H,5H2,1H3 |
| InChIKey | ORZHXGKPZJTHPI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |