C11H17N3 — CID 167592704
ethane;8-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 167592704) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is ethane;8-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | ethane;8-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 167592704 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | ethane;8-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC.CC(C)c1cccn2ncnc12 |
| InChI | InChI=1S/C9H11N3.C2H6/c1-7(2)8-4-3-5-12-9(8)10-6-11-12;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | IQEMMVNPVJGTGW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |