C7H6N4S — CID 82565691
[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide (PubChem CID 82565691) has the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. Its IUPAC name is [1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide.
| Compound Name | [1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide |
|---|---|
| PubChem CID | 82565691 |
| Molecular Formula | C7H6N4S |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | [1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide |
| SMILES | NC(=S)c1cccn2ncnc12 |
| InChI | InChI=1S/C7H6N4S/c8-6(12)5-2-1-3-11-7(5)9-4-10-11/h1-4H,(H2,8,12) |
| InChIKey | GWFVWTKPXAZFBP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|