2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid

C8H7N3O2 — CID 82599293

IUPAC2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid
SMILESO=C(O)Cc1cccn2ncnc12
InChIInChI=1S/C8H7N3O2/c12-7(13)4-6-2-1-3-11-8(6)9-5-10-11/h1-3,5H,4H2,(H,12,13)
InChIKeyXTEIXHLSNORQGD-UHFFFAOYSA-N
MW177.16 g/mol
LogP0.36
Rot. Bonds2

About 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid

2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid (PubChem CID 82599293) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid.

Molecular Properties

Compound Name2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid
PubChem CID82599293
Molecular FormulaC8H7N3O2
Molecular Weight177.16 g/mol
Exact Mass177.05
IUPAC Name2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid
SMILESO=C(O)Cc1cccn2ncnc12
InChIInChI=1S/C8H7N3O2/c12-7(13)4-6-2-1-3-11-8(6)9-5-10-11/h1-3,5H,4H2,(H,12,13)
InChIKeyXTEIXHLSNORQGD-UHFFFAOYSA-N
XLogP0.36
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.16
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid?
The IUPAC name of 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid (CID 82599293) is 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid.
What is the SMILES notation for 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid?
The canonical SMILES for 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid is O=C(O)Cc1cccn2ncnc12.
What is the InChIKey of 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid?
The InChIKey is XTEIXHLSNORQGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c12-7(13)4-6-2-1-3-11-8(6)9-5-10-11/h1-3,5H,4H2,(H,12,13).
What are the key properties of 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid?
2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid has a molecular weight of 177.16 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,2,4]triazolo[1,5-a]pyridin-8-yl)acetic acid is sourced from PubChem (CID 82599293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).