[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid

C6H4N4O2 — CID 84651764

IUPAC[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid
SMILESO=C(O)c1nccn2ncnc12
InChIInChI=1S/C6H4N4O2/c11-6(12)4-5-8-3-9-10(5)2-1-7-4/h1-3H,(H,11,12)
InChIKeyHWUSYYOCYRPSOB-UHFFFAOYSA-N
MW164.12 g/mol
LogP-0.18
Rot. Bonds1

About [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid

[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid (PubChem CID 84651764) has the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. Its IUPAC name is [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid.

Molecular Properties

Compound Name[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid
PubChem CID84651764
Molecular FormulaC6H4N4O2
Molecular Weight164.12 g/mol
Exact Mass164.03
IUPAC Name[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid
SMILESO=C(O)c1nccn2ncnc12
InChIInChI=1S/C6H4N4O2/c11-6(12)4-5-8-3-9-10(5)2-1-7-4/h1-3H,(H,11,12)
InChIKeyHWUSYYOCYRPSOB-UHFFFAOYSA-N
XLogP-0.18
TPSA80.38 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.12
LogP ≤ 5-0.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid?
The IUPAC name of [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid (CID 84651764) is [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid.
What is the SMILES notation for [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid?
The canonical SMILES for [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid is O=C(O)c1nccn2ncnc12.
What is the InChIKey of [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid?
The InChIKey is HWUSYYOCYRPSOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O2/c11-6(12)4-5-8-3-9-10(5)2-1-7-4/h1-3H,(H,11,12).
What are the key properties of [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid?
[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid has a molecular weight of 164.12 g/mol, XLogP of -0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid is sourced from PubChem (CID 84651764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).