3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid

C12H8N4O2 — CID 167894943

IUPAC3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid
SMILESO=C(O)c1cccc(-c2nccn3ncnc23)c1
InChIInChI=1S/C12H8N4O2/c17-12(18)9-3-1-2-8(6-9)10-11-14-7-15-16(11)5-4-13-10/h1-7H,(H,17,18)
InChIKeyMENVBUJGMHLOIN-UHFFFAOYSA-N
MW240.22 g/mol
LogP1.49
Rot. Bonds2

About 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid

3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid (PubChem CID 167894943) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid.

Molecular Properties

Compound Name3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid
PubChem CID167894943
Molecular FormulaC12H8N4O2
Molecular Weight240.22 g/mol
Exact Mass240.06
IUPAC Name3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid
SMILESO=C(O)c1cccc(-c2nccn3ncnc23)c1
InChIInChI=1S/C12H8N4O2/c17-12(18)9-3-1-2-8(6-9)10-11-14-7-15-16(11)5-4-13-10/h1-7H,(H,17,18)
InChIKeyMENVBUJGMHLOIN-UHFFFAOYSA-N
XLogP1.49
TPSA80.38 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.22
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid?
The IUPAC name of 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid (CID 167894943) is 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid.
What is the SMILES notation for 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid?
The canonical SMILES for 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid is O=C(O)c1cccc(-c2nccn3ncnc23)c1.
What is the InChIKey of 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid?
The InChIKey is MENVBUJGMHLOIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O2/c17-12(18)9-3-1-2-8(6-9)10-11-14-7-15-16(11)5-4-13-10/h1-7H,(H,17,18).
What are the key properties of 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid?
3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid has a molecular weight of 240.22 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-([1,2,4]triazolo[1,5-a]pyrazin-8-yl)benzoic acid is sourced from PubChem (CID 167894943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).