2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid

C7H6N4O2 — CID 84656310

IUPAC2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid
SMILESCc1nc2c(C(=O)O)nccn2n1
InChIInChI=1S/C7H6N4O2/c1-4-9-6-5(7(12)13)8-2-3-11(6)10-4/h2-3H,1H3,(H,12,13)
InChIKeySIEYMTRSKYQAKZ-UHFFFAOYSA-N
MW178.15 g/mol
LogP0.13
Rot. Bonds1

About 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid

2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid (PubChem CID 84656310) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid.

Molecular Properties

Compound Name2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid
PubChem CID84656310
Molecular FormulaC7H6N4O2
Molecular Weight178.15 g/mol
Exact Mass178.05
IUPAC Name2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid
SMILESCc1nc2c(C(=O)O)nccn2n1
InChIInChI=1S/C7H6N4O2/c1-4-9-6-5(7(12)13)8-2-3-11(6)10-4/h2-3H,1H3,(H,12,13)
InChIKeySIEYMTRSKYQAKZ-UHFFFAOYSA-N
XLogP0.13
TPSA80.38 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.15
LogP ≤ 50.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid?
The IUPAC name of 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid (CID 84656310) is 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid.
What is the SMILES notation for 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid?
The canonical SMILES for 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid is Cc1nc2c(C(=O)O)nccn2n1.
What is the InChIKey of 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid?
The InChIKey is SIEYMTRSKYQAKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c1-4-9-6-5(7(12)13)8-2-3-11(6)10-4/h2-3H,1H3,(H,12,13).
What are the key properties of 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid?
2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid has a molecular weight of 178.15 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-[1,2,4]triazolo[1,5-a]pyrazine-8-carboxylic acid is sourced from PubChem (CID 84656310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).