C13H8N6O2 — CID 68717514
4-amino-5-(4-nitrophenyl)pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile (PubChem CID 68717514) has the molecular formula C13H8N6O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 4-amino-5-(4-nitrophenyl)pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile.
| Compound Name | 4-amino-5-(4-nitrophenyl)pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile |
|---|---|
| PubChem CID | 68717514 |
| Molecular Formula | C13H8N6O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-amino-5-(4-nitrophenyl)pyrrolo[2,1-f][1,2,4]triazine-6-carbonitrile |
| SMILES | N#Cc1cn2ncnc(N)c2c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H8N6O2/c14-5-9-6-18-12(13(15)16-7-17-18)11(9)8-1-3-10(4-2-8)19(20)21/h1-4,6-7H,(H2,15,16,17) |
| InChIKey | WWVVEFSNFWSBAO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|