C13H8N6O2 — CID 59251003
7-isocyano-8-(4-nitrophenyl)pyrrolo[1,2-d][1,2,4]triazin-1-amine (PubChem CID 59251003) has the molecular formula C13H8N6O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 7-isocyano-8-(4-nitrophenyl)pyrrolo[1,2-d][1,2,4]triazin-1-amine.
| Compound Name | 7-isocyano-8-(4-nitrophenyl)pyrrolo[1,2-d][1,2,4]triazin-1-amine |
|---|---|
| PubChem CID | 59251003 |
| Molecular Formula | C13H8N6O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 7-isocyano-8-(4-nitrophenyl)pyrrolo[1,2-d][1,2,4]triazin-1-amine |
| SMILES | [C-]#[N+]c1cn2cnnc(N)c2c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H8N6O2/c1-15-10-6-18-7-16-17-13(14)12(18)11(10)8-2-4-9(5-3-8)19(20)21/h2-7H,(H2,14,17) |
| InChIKey | KXWPMWCDUJMRQC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|