C19H15FN6O2 — CID 17172564
7-ethyl-8-(4-fluorophenyl)-3-(4-nitrophenyl)pyrazolo[5,1-c][1,2,4]triazin-4-amine (PubChem CID 17172564) has the molecular formula C19H15FN6O2 and a molecular weight of 378.37 g/mol. Its IUPAC name is 7-ethyl-8-(4-fluorophenyl)-3-(4-nitrophenyl)pyrazolo[5,1-c][1,2,4]triazin-4-amine.
| Compound Name | 7-ethyl-8-(4-fluorophenyl)-3-(4-nitrophenyl)pyrazolo[5,1-c][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 17172564 |
| Molecular Formula | C19H15FN6O2 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 7-ethyl-8-(4-fluorophenyl)-3-(4-nitrophenyl)pyrazolo[5,1-c][1,2,4]triazin-4-amine |
| SMILES | CCc1nn2c(N)c(-c3ccc([N+](=O)[O-])cc3)nnc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15FN6O2/c1-2-15-16(11-3-7-13(20)8-4-11)19-23-22-17(18(21)25(19)24-15)12-5-9-14(10-6-12)26(27)28/h3-10H,2,21H2,1H3 |
| InChIKey | NZNZKPGXILQDSD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|